| Name | L-Homocysteine |
| Synonyms | NSC 43117 H-Hcys-OH NSC 118376 L-HOMOCYSTEINE L-Homocysteine (S)-HOMOCYSTEINE Homocysteine (VAN) Butyric acid, 2-amino-4-mercapto- (2S)-2-ammonio-4-mercaptobutanoate (S)-2-AMINO-4-MERCAPTOBUTANOIC ACID 2-Amino-4-mercaptobutyric acid (VAN) BUTYRIC ACID, 2-AMINO-4-MERCAPTO-, L- Butyric acid, 2-amino-4-mercapto- (8CI) Butanoic acid, 2-amino-4-mercapto-, (S)- BUTANOIC ACID, 2-AMINO-4-MERCAPTO-, (S)- Butanoic acid, 2-amino-4-mercapto- (VAN) (S)-2-Amino-4-(methylmercapto)butanoic acid Butyric acid, 2-amino-4-mercapto-, L- (8CI) |
| CAS | 6027-13-0 |
| EINECS | 227-891-0 |
| InChI | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | FFFHZYDWPBMWHY-VKHMYHEASA-N |
| Molecular Formula | C4H9NO2S |
| Molar Mass | 135.18 |
| Density | 1.149 (estimate) |
| Melting Point | 232°C |
| Boling Point | 299.7±35.0 °C(Predicted) |
| Solubility | Aqueous Acid (Sparingly, Heated, Sonicated), Water (Slightly, Heated) |
| Appearance | solid |
| Color | White to Off-White |
| pKa | 2.24±0.10(Predicted) |
| Storage Condition | -20°C |
| Stability | Air Sensitive, Hygroscopic |
| Refractive Index | 1.5480 (estimate) |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Reference Show more | 1. [IF=9.594] Zhongqian Song et al."Multifunctional N,S co-doped carbon quantum dots with pH- and thermo-dependent switchable fluorescent properties and highly selective detection of glutathione."Carbon. 2016 Aug;104:169 2. [IF=1.448] Xiaoqin Zhong et al."Scutellarin‑treated exosomes increase claudin 5, occludin and ZO1 expression in rat brain microvascular endothelial cells."Exp Ther Med. 2019 Jul;18(1):33-40 |